C18H21F3N2S — CID 67916028
2-(3,7-dimethylocta-2,6-dienylsulfanyl)-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 67916028) has the molecular formula C18H21F3N2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienylsulfanyl)-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienylsulfanyl)-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 67916028 |
| Molecular Formula | C18H21F3N2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienylsulfanyl)-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | CC(C)=CCCC(C)=CCSc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C18H21F3N2S/c1-12(2)5-4-6-13(3)9-10-24-17-22-15-8-7-14(18(19,20)21)11-16(15)23-17/h5,7-9,11H,4,6,10H2,1-3H3,(H,22,23) |
| InChIKey | QMVUKWGYFLFFCR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|