C23H22N4O — CID 67916093
N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13,15-heptaene-15-carboxamide (PubChem CID 67916093) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13,15-heptaene-15-carboxamide.
| Compound Name | N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13,15-heptaene-15-carboxamide |
|---|---|
| PubChem CID | 67916093 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10(17),11,13,15-heptaene-15-carboxamide |
| SMILES | Cc1[nH]cnc1CN(C)C(=O)c1cn2c3c(cccc13)CCc1ccccc1-2 |
| InChI | InChI=1S/C23H22N4O/c1-15-20(25-14-24-15)13-26(2)23(28)19-12-27-21-9-4-3-6-16(21)10-11-17-7-5-8-18(19)22(17)27/h3-9,12,14H,10-11,13H2,1-2H3,(H,24,25) |
| InChIKey | QGMNUOVEBRELDL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |