C20H16ClN5 — CID 67916186
(4R)-7-chloro-4-methyl-5,10-diphenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene (PubChem CID 67916186) has the molecular formula C20H16ClN5 and a molecular weight of 361.84 g/mol. Its IUPAC name is (4R)-7-chloro-4-methyl-5,10-diphenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene.
| Compound Name | (4R)-7-chloro-4-methyl-5,10-diphenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
|---|---|
| PubChem CID | 67916186 |
| Molecular Formula | C20H16ClN5 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (4R)-7-chloro-4-methyl-5,10-diphenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
| SMILES | C[C@H]1N=C2c3cnn(-c4ccccc4)c3N=C(Cl)N2C1c1ccccc1 |
| InChI | InChI=1S/C20H16ClN5/c1-13-17(14-8-4-2-5-9-14)25-18(23-13)16-12-22-26(19(16)24-20(25)21)15-10-6-3-7-11-15/h2-13,17H,1H3/t13-,17?/m1/s1 |
| InChIKey | DHZHSAMLDLGMRO-FWJOYPJLSA-N |
| XLogP | 4.30 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|