C29H34ClN3OS2 — CID 67916245
4-[4-[2-benzyl-4-(4-chlorophenyl)piperazin-1-yl]butyl]-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one (PubChem CID 67916245) has the molecular formula C29H34ClN3OS2 and a molecular weight of 540.20 g/mol. Its IUPAC name is 4-[4-[2-benzyl-4-(4-chlorophenyl)piperazin-1-yl]butyl]-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one.
| Compound Name | 4-[4-[2-benzyl-4-(4-chlorophenyl)piperazin-1-yl]butyl]-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 67916245 |
| Molecular Formula | C29H34ClN3OS2 |
| Molecular Weight | 540.20 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 4-[4-[2-benzyl-4-(4-chlorophenyl)piperazin-1-yl]butyl]-7-methyl-2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-one |
| SMILES | Cc1cc2c(s1)SCCN(CCCCN1CCN(c3ccc(Cl)cc3)CC1Cc1ccccc1)C2=O |
| InChI | InChI=1S/C29H34ClN3OS2/c1-22-19-27-28(34)32(17-18-35-29(27)36-22)14-6-5-13-31-15-16-33(25-11-9-24(30)10-12-25)21-26(31)20-23-7-3-2-4-8-23/h2-4,7-12,19,26H,5-6,13-18,20-21H2,1H3 |
| InChIKey | TWABQCYTVNASRF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.20 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|