C10H11N4NaO5S — CID 67916256
sodium (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-(1,2,4-triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 67916256) has the molecular formula C10H11N4NaO5S and a molecular weight of 322.28 g/mol. Its IUPAC name is sodium (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-(1,2,4-triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-(1,2,4-triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 67916256 |
| Molecular Formula | C10H11N4NaO5S |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | sodium (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-(1,2,4-triazol-1-ylmethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(Cn2cncn2)[C@H](C(=O)[O-])N2C(=O)C[C@@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C10H12N4O5S.Na/c1-10(3-13-5-11-4-12-13)8(9(16)17)14-6(15)2-7(14)20(10,18)19;/h4-5,7-8H,2-3H2,1H3,(H,16,17);/q;+1/p-1/t7-,8-,10-;/m0./s1 |
| InChIKey | QRLYTBRVHHTDPW-KBMNZXMKSA-M |
| XLogP | -5.85 |
| TPSA | 125.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |