C27H25N3O7S — CID 67916609
3-methoxy-4-[(1-methyl-5-nitroindol-3-yl)methyl]-N-[2-[(E)-prop-1-enoxy]phenyl]sulfonylbenzamide (PubChem CID 67916609) has the molecular formula C27H25N3O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is 3-methoxy-4-[(1-methyl-5-nitroindol-3-yl)methyl]-N-[2-[(E)-prop-1-enoxy]phenyl]sulfonylbenzamide.
| Compound Name | 3-methoxy-4-[(1-methyl-5-nitroindol-3-yl)methyl]-N-[2-[(E)-prop-1-enoxy]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67916609 |
| Molecular Formula | C27H25N3O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 3-methoxy-4-[(1-methyl-5-nitroindol-3-yl)methyl]-N-[2-[(E)-prop-1-enoxy]phenyl]sulfonylbenzamide |
| SMILES | C/C=C/Oc1ccccc1S(=O)(=O)NC(=O)c1ccc(Cc2cn(C)c3ccc([N+](=O)[O-])cc23)c(OC)c1 |
| InChI | InChI=1S/C27H25N3O7S/c1-4-13-37-24-7-5-6-8-26(24)38(34,35)28-27(31)19-10-9-18(25(15-19)36-3)14-20-17-29(2)23-12-11-21(30(32)33)16-22(20)23/h4-13,15-17H,14H2,1-3H3,(H,28,31)/b13-4+ |
| InChIKey | WREFUYCPAXEJFS-YIXHJXPBSA-N |
| XLogP | 4.72 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|