C29H34N2O4 — CID 67916847
bis[4-(2-cyanoethyl)-2,3-diethylphenyl] propanedioate (PubChem CID 67916847) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is bis[4-(2-cyanoethyl)-2,3-diethylphenyl] propanedioate.
| Compound Name | bis[4-(2-cyanoethyl)-2,3-diethylphenyl] propanedioate |
|---|---|
| PubChem CID | 67916847 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | bis[4-(2-cyanoethyl)-2,3-diethylphenyl] propanedioate |
| SMILES | CCc1c(CCC#N)ccc(OC(=O)CC(=O)Oc2ccc(CCC#N)c(CC)c2CC)c1CC |
| InChI | InChI=1S/C29H34N2O4/c1-5-22-20(11-9-17-30)13-15-26(24(22)7-3)34-28(32)19-29(33)35-27-16-14-21(12-10-18-31)23(6-2)25(27)8-4/h13-16H,5-12,19H2,1-4H3 |
| InChIKey | GARCNGYNTUNOJL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|