C29H30N2O3 — CID 67916995
2-[2-[[5-butan-2-yl-2-oxo-3-(2-phenylethyl)imidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 67916995) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[2-[[5-butan-2-yl-2-oxo-3-(2-phenylethyl)imidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[[5-butan-2-yl-2-oxo-3-(2-phenylethyl)imidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67916995 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[2-[[5-butan-2-yl-2-oxo-3-(2-phenylethyl)imidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCC(C)c1cn(CCc2ccccc2)c(=O)n1Cc1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C29H30N2O3/c1-3-21(2)27-20-30(18-17-22-11-5-4-6-12-22)29(34)31(27)19-23-13-7-8-14-24(23)25-15-9-10-16-26(25)28(32)33/h4-16,20-21H,3,17-19H2,1-2H3,(H,32,33) |
| InChIKey | LWYMKGNWNZSTPO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |