About 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran
5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 67917175) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
| PubChem CID | 67917175 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCOC1=COC(CC)C(C)C1C |
| InChI | InChI=1S/C11H20O2/c1-5-10-8(3)9(4)11(7-13-10)12-6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | WTUBCDBAVCUXTC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The IUPAC name of 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran (CID 67917175) is 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran is CCOC1=COC(CC)C(C)C1C.
What is the InChIKey of 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
The InChIKey is WTUBCDBAVCUXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-10-8(3)9(4)11(7-13-10)12-6-2/h7-10H,5-6H2,1-4H3.
What are the key properties of 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran?
5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran has a molecular weight of 184.28 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 67917175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).