C27H48N4O8 — CID 67917224
2-[1,1-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid (PubChem CID 67917224) has the molecular formula C27H48N4O8 and a molecular weight of 556.70 g/mol. Its IUPAC name is 2-[1,1-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid.
| Compound Name | 2-[1,1-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
|---|---|
| PubChem CID | 67917224 |
| Molecular Formula | C27H48N4O8 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | 2-[1,1-bis(1-carbamoyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
| SMILES | CCCC(C1CC(C)(C)N(OC(N)=O)C(C)(C)C1)(C1CC(C)(C)N(OC(N)=O)C(C)(C)C1)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C27H48N4O8/c1-10-11-27(18(19(32)33)20(34)35,16-12-23(2,3)30(38-21(28)36)24(4,5)13-16)17-14-25(6,7)31(39-22(29)37)26(8,9)15-17/h16-18H,10-15H2,1-9H3,(H2,28,36)(H2,29,37)(H,32,33)(H,34,35) |
| InChIKey | OPEMVNGOEFBJKA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 185.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|