C16H19N5O3 — CID 67917373
(2S)-2-[[(3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanediamide (PubChem CID 67917373) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-2-[[(3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanediamide.
| Compound Name | (2S)-2-[[(3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanediamide |
|---|---|
| PubChem CID | 67917373 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (2S)-2-[[(3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanediamide |
| SMILES | NC(=O)C[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)CN1)C(N)=O |
| InChI | InChI=1S/C16H19N5O3/c17-14(22)6-11(15(18)23)21-16(24)12-5-9-8-3-1-2-4-10(8)20-13(9)7-19-12/h1-4,11-12,19-20H,5-7H2,(H2,17,22)(H2,18,23)(H,21,24)/t11-,12-/m0/s1 |
| InChIKey | QVEYLMTYRVRRPI-RYUDHWBXSA-N |
| XLogP | -0.97 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|