About 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole
2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole (PubChem CID 67917501) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole |
| PubChem CID | 67917501 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole |
| SMILES | CC1COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1 |
| InChI | InChI=1S/C20H20N2O2/c1-14-12-23-20(24-13-14)19-21-17(15-8-4-2-5-9-15)18(22-19)16-10-6-3-7-11-16/h2-11,14,20H,12-13H2,1H3,(H,21,22) |
| InChIKey | NXKAPFBQBVWPNN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole (CID 67917501) is 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole is CC1COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1.
What is the InChIKey of 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole?
The InChIKey is NXKAPFBQBVWPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-14-12-23-20(24-13-14)19-21-17(15-8-4-2-5-9-15)18(22-19)16-10-6-3-7-11-16/h2-11,14,20H,12-13H2,1H3,(H,21,22).
What are the key properties of 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole?
2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole has a molecular weight of 320.39 g/mol, XLogP of 4.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3-dioxan-2-yl)-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 67917501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).