About 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one
9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one (PubChem CID 67917975) has the molecular formula C17H14FNO
and a molecular weight of 267.30 g/mol. Its IUPAC name is 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one.
Molecular Properties
| Compound Name | 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one |
| PubChem CID | 67917975 |
| Molecular Formula | C17H14FNO |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one |
| SMILES | O=C1c2ccccc2C2(c3cccc(F)c3)CCCN12 |
| InChI | InChI=1S/C17H14FNO/c18-13-6-3-5-12(11-13)17-9-4-10-19(17)16(20)14-7-1-2-8-15(14)17/h1-3,5-8,11H,4,9-10H2 |
| InChIKey | APFQSUUVSPLPNJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The IUPAC name of 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one (CID 67917975) is 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one.
What is the SMILES notation for 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The canonical SMILES for 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one is O=C1c2ccccc2C2(c3cccc(F)c3)CCCN12.
What is the InChIKey of 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
The InChIKey is APFQSUUVSPLPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FNO/c18-13-6-3-5-12(11-13)17-9-4-10-19(17)16(20)14-7-1-2-8-15(14)17/h1-3,5-8,11H,4,9-10H2.
What are the key properties of 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one?
9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one has a molecular weight of 267.30 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-(3-fluorophenyl)-2,3-dihydro-1H-pyrrolo[2,1-a]isoindol-5-one is sourced from PubChem (CID 67917975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).