About 6-methoxy-5H-indol-2-ol
6-methoxy-5H-indol-2-ol (PubChem CID 67918006) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 6-methoxy-5H-indol-2-ol.
Molecular Properties
| Compound Name | 6-methoxy-5H-indol-2-ol |
| PubChem CID | 67918006 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 6-methoxy-5H-indol-2-ol |
| SMILES | COC1=CC2=NC(O)=CC2=CC1 |
| InChI | InChI=1S/C9H9NO2/c1-12-7-3-2-6-4-9(11)10-8(6)5-7/h2,4-5,11H,3H2,1H3 |
| InChIKey | RZZTWORAMVNBBQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-5H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-5H-indol-2-ol?
The IUPAC name of 6-methoxy-5H-indol-2-ol (CID 67918006) is 6-methoxy-5H-indol-2-ol.
What is the SMILES notation for 6-methoxy-5H-indol-2-ol?
The canonical SMILES for 6-methoxy-5H-indol-2-ol is COC1=CC2=NC(O)=CC2=CC1.
What is the InChIKey of 6-methoxy-5H-indol-2-ol?
The InChIKey is RZZTWORAMVNBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-12-7-3-2-6-4-9(11)10-8(6)5-7/h2,4-5,11H,3H2,1H3.
What are the key properties of 6-methoxy-5H-indol-2-ol?
6-methoxy-5H-indol-2-ol has a molecular weight of 163.18 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-5H-indol-2-ol is sourced from PubChem (CID 67918006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).