C26H34ClN3O5 — CID 67918240
7,8-dimethoxy-3-[[1-[2-(4-nitrophenyl)ethyl]piperidin-3-yl]methyl]-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride (PubChem CID 67918240) has the molecular formula C26H34ClN3O5 and a molecular weight of 504.03 g/mol. Its IUPAC name is 7,8-dimethoxy-3-[[1-[2-(4-nitrophenyl)ethyl]piperidin-3-yl]methyl]-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride.
| Compound Name | 7,8-dimethoxy-3-[[1-[2-(4-nitrophenyl)ethyl]piperidin-3-yl]methyl]-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride |
|---|---|
| PubChem CID | 67918240 |
| Molecular Formula | C26H34ClN3O5 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 7,8-dimethoxy-3-[[1-[2-(4-nitrophenyl)ethyl]piperidin-3-yl]methyl]-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CC1CCCN(CCc3ccc([N+](=O)[O-])cc3)C1)CC2.Cl |
| InChI | InChI=1S/C26H33N3O5.ClH/c1-33-24-14-21-10-13-28(26(30)16-22(21)15-25(24)34-2)18-20-4-3-11-27(17-20)12-9-19-5-7-23(8-6-19)29(31)32;/h5-8,14-15,20H,3-4,9-13,16-18H2,1-2H3;1H |
| InChIKey | ZWDKSKKQWRNCBS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|