C18H23NO5 — CID 67918250
(3'aR,4R,6'R,6'aR)-2,2',2'-trimethyl-6'-(phenylmethoxymethyl)spiro[5H-1,3-oxazole-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] (PubChem CID 67918250) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3'aR,4R,6'R,6'aR)-2,2',2'-trimethyl-6'-(phenylmethoxymethyl)spiro[5H-1,3-oxazole-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole].
| Compound Name | (3'aR,4R,6'R,6'aR)-2,2',2'-trimethyl-6'-(phenylmethoxymethyl)spiro[5H-1,3-oxazole-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] |
|---|---|
| PubChem CID | 67918250 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3'aR,4R,6'R,6'aR)-2,2',2'-trimethyl-6'-(phenylmethoxymethyl)spiro[5H-1,3-oxazole-4,4'-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole] |
| SMILES | CC1=N[C@]2(CO1)O[C@H](COCc1ccccc1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H23NO5/c1-12-19-18(11-21-12)16-15(23-17(2,3)24-16)14(22-18)10-20-9-13-7-5-4-6-8-13/h4-8,14-16H,9-11H2,1-3H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | UXZWMNGWTASXSK-YFHUEUNASA-N |
| XLogP | 2.27 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |