About [(1S)-1-phenylethyl] carbamate
[(1S)-1-phenylethyl] carbamate (PubChem CID 67918357) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] carbamate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] carbamate |
| PubChem CID | 67918357 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | [(1S)-1-phenylethyl] carbamate |
| SMILES | C[C@H](OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c1-7(12-9(10)11)8-5-3-2-4-6-8/h2-7H,1H3,(H2,10,11)/t7-/m0/s1 |
| InChIKey | HLRAZPBRONOBEX-ZETCQYMHSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-phenylethyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] carbamate?
The IUPAC name of [(1S)-1-phenylethyl] carbamate (CID 67918357) is [(1S)-1-phenylethyl] carbamate.
What is the SMILES notation for [(1S)-1-phenylethyl] carbamate?
The canonical SMILES for [(1S)-1-phenylethyl] carbamate is C[C@H](OC(N)=O)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylethyl] carbamate?
The InChIKey is HLRAZPBRONOBEX-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7(12-9(10)11)8-5-3-2-4-6-8/h2-7H,1H3,(H2,10,11)/t7-/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] carbamate?
[(1S)-1-phenylethyl] carbamate has a molecular weight of 165.19 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] carbamate is sourced from PubChem (CID 67918357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).