About N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine
N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine (PubChem CID 67918394) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine |
| PubChem CID | 67918394 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine |
| SMILES | C=CC1(OCC)C=CC(NCCN)=CC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-12(15-4-2)7-5-11(6-8-12)14-10-9-13/h3,5-7,14H,1,4,8-10,13H2,2H3 |
| InChIKey | XBWOEWFGSVZJLG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine?
The IUPAC name of N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine (CID 67918394) is N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine is C=CC1(OCC)C=CC(NCCN)=CC1.
What is the InChIKey of N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine?
The InChIKey is XBWOEWFGSVZJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-3-12(15-4-2)7-5-11(6-8-12)14-10-9-13/h3,5-7,14H,1,4,8-10,13H2,2H3.
What are the key properties of N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine?
N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine has a molecular weight of 208.30 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-ethenyl-4-ethoxycyclohexa-1,5-dien-1-yl)ethane-1,2-diamine is sourced from PubChem (CID 67918394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).