About 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine
6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine (PubChem CID 67918482) has the molecular formula C20H21F2NO2
and a molecular weight of 345.39 g/mol. Its IUPAC name is 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine.
Molecular Properties
| Compound Name | 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine |
| PubChem CID | 67918482 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine |
| SMILES | CCC1(COCc2c(F)cccc2F)CCC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C20H21F2NO2/c1-2-20(14-24-13-16-17(21)9-6-10-18(16)22)12-11-19(23-25-20)15-7-4-3-5-8-15/h3-10H,2,11-14H2,1H3 |
| InChIKey | LNKNNWHQFWYLIJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine?
The IUPAC name of 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine (CID 67918482) is 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine.
What is the SMILES notation for 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine?
The canonical SMILES for 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine is CCC1(COCc2c(F)cccc2F)CCC(c2ccccc2)=NO1.
What is the InChIKey of 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine?
The InChIKey is LNKNNWHQFWYLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2NO2/c1-2-20(14-24-13-16-17(21)9-6-10-18(16)22)12-11-19(23-25-20)15-7-4-3-5-8-15/h3-10H,2,11-14H2,1H3.
What are the key properties of 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine?
6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine has a molecular weight of 345.39 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,6-difluorophenyl)methoxymethyl]-6-ethyl-3-phenyl-4,5-dihydrooxazine is sourced from PubChem (CID 67918482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).