C19H23NO5 — CID 67919462
benzyl 1-[(6S,7S)-2,2-dimethyl-5-methylidene-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]ethyl carbonate (PubChem CID 67919462) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is benzyl 1-[(6S,7S)-2,2-dimethyl-5-methylidene-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]ethyl carbonate.
| Compound Name | benzyl 1-[(6S,7S)-2,2-dimethyl-5-methylidene-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]ethyl carbonate |
|---|---|
| PubChem CID | 67919462 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | benzyl 1-[(6S,7S)-2,2-dimethyl-5-methylidene-8-oxo-3-oxa-1-azabicyclo[4.2.0]octan-7-yl]ethyl carbonate |
| SMILES | C=C1COC(C)(C)N2C(=O)[C@H](C(C)OC(=O)OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C19H23NO5/c1-12-10-24-19(3,4)20-16(12)15(17(20)21)13(2)25-18(22)23-11-14-8-6-5-7-9-14/h5-9,13,15-16H,1,10-11H2,2-4H3/t13?,15-,16-/m1/s1 |
| InChIKey | NKLIECAVCDLJBO-GNHXQJIDSA-N |
| XLogP | 2.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|