About pyrido[2,3-b][1,4]benzodiazepin-2-one
pyrido[2,3-b][1,4]benzodiazepin-2-one (PubChem CID 67919580) has the molecular formula C12H7N3O
and a molecular weight of 209.21 g/mol. Its IUPAC name is pyrido[2,3-b][1,4]benzodiazepin-2-one.
Molecular Properties
| Compound Name | pyrido[2,3-b][1,4]benzodiazepin-2-one |
| PubChem CID | 67919580 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | pyrido[2,3-b][1,4]benzodiazepin-2-one |
| SMILES | O=c1ccc2ncc3ccccc3nc-2n1 |
| InChI | InChI=1S/C12H7N3O/c16-11-6-5-10-12(15-11)14-9-4-2-1-3-8(9)7-13-10/h1-7H |
| InChIKey | LDZJARBEIDPEEY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrido[2,3-b][1,4]benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-b][1,4]benzodiazepin-2-one?
The IUPAC name of pyrido[2,3-b][1,4]benzodiazepin-2-one (CID 67919580) is pyrido[2,3-b][1,4]benzodiazepin-2-one.
What is the SMILES notation for pyrido[2,3-b][1,4]benzodiazepin-2-one?
The canonical SMILES for pyrido[2,3-b][1,4]benzodiazepin-2-one is O=c1ccc2ncc3ccccc3nc-2n1.
What is the InChIKey of pyrido[2,3-b][1,4]benzodiazepin-2-one?
The InChIKey is LDZJARBEIDPEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O/c16-11-6-5-10-12(15-11)14-9-4-2-1-3-8(9)7-13-10/h1-7H.
What are the key properties of pyrido[2,3-b][1,4]benzodiazepin-2-one?
pyrido[2,3-b][1,4]benzodiazepin-2-one has a molecular weight of 209.21 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-b][1,4]benzodiazepin-2-one is sourced from PubChem (CID 67919580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).