C10H15NO3 — CID 67919744
(Z)-5-[(2-cyclopropylacetyl)amino]pent-2-enoic acid (PubChem CID 67919744) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (Z)-5-[(2-cyclopropylacetyl)amino]pent-2-enoic acid.
| Compound Name | (Z)-5-[(2-cyclopropylacetyl)amino]pent-2-enoic acid |
|---|---|
| PubChem CID | 67919744 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (Z)-5-[(2-cyclopropylacetyl)amino]pent-2-enoic acid |
| SMILES | O=C(O)/C=C\CCNC(=O)CC1CC1 |
| InChI | InChI=1S/C10H15NO3/c12-9(7-8-4-5-8)11-6-2-1-3-10(13)14/h1,3,8H,2,4-7H2,(H,11,12)(H,13,14)/b3-1- |
| InChIKey | ZNJAPEJDPKNAHW-IWQZZHSRSA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|