C33H33NO10 — CID 67919921
bis(2-acetyloxyethyl) 2,6-dimethyl-4-(3-methyl-4-oxo-2-phenylchromen-8-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67919921) has the molecular formula C33H33NO10 and a molecular weight of 603.62 g/mol. Its IUPAC name is bis(2-acetyloxyethyl) 2,6-dimethyl-4-(3-methyl-4-oxo-2-phenylchromen-8-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-acetyloxyethyl) 2,6-dimethyl-4-(3-methyl-4-oxo-2-phenylchromen-8-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67919921 |
| Molecular Formula | C33H33NO10 |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | bis(2-acetyloxyethyl) 2,6-dimethyl-4-(3-methyl-4-oxo-2-phenylchromen-8-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC(=O)OCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCOC(C)=O)C1c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C33H33NO10/c1-18-29(37)25-13-9-12-24(31(25)44-30(18)23-10-7-6-8-11-23)28-26(32(38)42-16-14-40-21(4)35)19(2)34-20(3)27(28)33(39)43-17-15-41-22(5)36/h6-13,28,34H,14-17H2,1-5H3 |
| InChIKey | AXAJYXCNWMNUPM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|