C12H24ClN — CID 67920234
(4aR,8aS)-1,1,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline;hydrochloride (PubChem CID 67920234) has the molecular formula C12H24ClN and a molecular weight of 217.78 g/mol. Its IUPAC name is (4aR,8aS)-1,1,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline;hydrochloride.
| Compound Name | (4aR,8aS)-1,1,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 67920234 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (4aR,8aS)-1,1,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline;hydrochloride |
| SMILES | CC1(C)NCC[C@H]2CCCC[C@@]21C.Cl |
| InChI | InChI=1S/C12H23N.ClH/c1-11(2)12(3)8-5-4-6-10(12)7-9-13-11;/h10,13H,4-9H2,1-3H3;1H/t10-,12+;/m1./s1 |
| InChIKey | PFIXXFYPXVCZRS-IYJPBCIQSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |