About 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol
1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol (PubChem CID 67920786) has the molecular formula C18H19N3O5
and a molecular weight of 357.37 g/mol. Its IUPAC name is 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol |
| PubChem CID | 67920786 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol |
| SMILES | CC(O)C(Oc1ccc([N+](=O)[O-])cc1)N(C)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C18H19N3O5/c1-12(22)18(25-14-9-7-13(8-10-14)21(23)24)20(2)11-17-19-15-5-3-4-6-16(15)26-17/h3-10,12,18,22H,11H2,1-2H3 |
| InChIKey | VSWRQZGNNQZZGQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol?
The IUPAC name of 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol (CID 67920786) is 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol.
What is the SMILES notation for 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol?
The canonical SMILES for 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol is CC(O)C(Oc1ccc([N+](=O)[O-])cc1)N(C)Cc1nc2ccccc2o1.
What is the InChIKey of 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol?
The InChIKey is VSWRQZGNNQZZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5/c1-12(22)18(25-14-9-7-13(8-10-14)21(23)24)20(2)11-17-19-15-5-3-4-6-16(15)26-17/h3-10,12,18,22H,11H2,1-2H3.
What are the key properties of 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol?
1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol has a molecular weight of 357.37 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,3-benzoxazol-2-ylmethyl(methyl)amino]-1-(4-nitrophenoxy)propan-2-ol is sourced from PubChem (CID 67920786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).