About (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate
(6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate (PubChem CID 67921375) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate |
| PubChem CID | 67921375 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate |
| SMILES | CC(C)=C1CC=CC=C1OC(=O)O |
| InChI | InChI=1S/C10H12O3/c1-7(2)8-5-3-4-6-9(8)13-10(11)12/h3-4,6H,5H2,1-2H3,(H,11,12) |
| InChIKey | IAMXISCPGHNUDU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The IUPAC name of (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate (CID 67921375) is (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate.
What is the SMILES notation for (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The canonical SMILES for (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate is CC(C)=C1CC=CC=C1OC(=O)O.
What is the InChIKey of (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The InChIKey is IAMXISCPGHNUDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7(2)8-5-3-4-6-9(8)13-10(11)12/h3-4,6H,5H2,1-2H3,(H,11,12).
What are the key properties of (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate?
(6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate has a molecular weight of 180.20 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-propan-2-ylidenecyclohexa-1,3-dien-1-yl) hydrogen carbonate is sourced from PubChem (CID 67921375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).