About 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one
1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one (PubChem CID 67921687) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one |
| PubChem CID | 67921687 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one |
| SMILES | CC#Cc1ccc2c(c1)C(N1CCCC1=O)=C(O)C(C)(C)O2 |
| InChI | InChI=1S/C18H19NO3/c1-4-6-12-8-9-14-13(11-12)16(17(21)18(2,3)22-14)19-10-5-7-15(19)20/h8-9,11,21H,5,7,10H2,1-3H3 |
| InChIKey | OCHRSKPRRQOOKS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one?
The IUPAC name of 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one (CID 67921687) is 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one.
What is the SMILES notation for 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one?
The canonical SMILES for 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one is CC#Cc1ccc2c(c1)C(N1CCCC1=O)=C(O)C(C)(C)O2.
What is the InChIKey of 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one?
The InChIKey is OCHRSKPRRQOOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-4-6-12-8-9-14-13(11-12)16(17(21)18(2,3)22-14)19-10-5-7-15(19)20/h8-9,11,21H,5,7,10H2,1-3H3.
What are the key properties of 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one?
1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one has a molecular weight of 297.35 g/mol, XLogP of 3.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-2,2-dimethyl-6-prop-1-ynylchromen-4-yl)pyrrolidin-2-one is sourced from PubChem (CID 67921687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).