About (2S)-3,3-diphenylpyrrolidine-2-carboxamide
(2S)-3,3-diphenylpyrrolidine-2-carboxamide (PubChem CID 67922087) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-3,3-diphenylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-3,3-diphenylpyrrolidine-2-carboxamide |
| PubChem CID | 67922087 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2S)-3,3-diphenylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1NCCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c18-16(20)15-17(11-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,19H,11-12H2,(H2,18,20)/t15-/m1/s1 |
| InChIKey | JUNQEKZYWVMMRU-OAHLLOKOSA-N |
| XLogP | 1.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3,3-diphenylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-diphenylpyrrolidine-2-carboxamide?
The IUPAC name of (2S)-3,3-diphenylpyrrolidine-2-carboxamide (CID 67922087) is (2S)-3,3-diphenylpyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-3,3-diphenylpyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-3,3-diphenylpyrrolidine-2-carboxamide is NC(=O)[C@H]1NCCC1(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-3,3-diphenylpyrrolidine-2-carboxamide?
The InChIKey is JUNQEKZYWVMMRU-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H18N2O/c18-16(20)15-17(11-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,19H,11-12H2,(H2,18,20)/t15-/m1/s1.
What are the key properties of (2S)-3,3-diphenylpyrrolidine-2-carboxamide?
(2S)-3,3-diphenylpyrrolidine-2-carboxamide has a molecular weight of 266.34 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-diphenylpyrrolidine-2-carboxamide is sourced from PubChem (CID 67922087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).