C12H16BrNO4S — CID 67922674
9-(4-bromobutyl)-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione (PubChem CID 67922674) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 9-(4-bromobutyl)-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione.
| Compound Name | 9-(4-bromobutyl)-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
|---|---|
| PubChem CID | 67922674 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 9-(4-bromobutyl)-4,4-dioxo-4λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
| SMILES | O=C1C2C3CS(=O)(=O)CC3C2C(=O)N1CCCCBr |
| InChI | InChI=1S/C12H16BrNO4S/c13-3-1-2-4-14-11(15)9-7-5-19(17,18)6-8(7)10(9)12(14)16/h7-10H,1-6H2 |
| InChIKey | BTLJXWLORGWKFQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|