C13H22ClN3O3 — CID 67922786
1-N',1-N'-diethyl-1-N-(2-methoxy-4-nitrophenyl)ethane-1,1-diamine;hydrochloride (PubChem CID 67922786) has the molecular formula C13H22ClN3O3 and a molecular weight of 303.79 g/mol. Its IUPAC name is 1-N',1-N'-diethyl-1-N-(2-methoxy-4-nitrophenyl)ethane-1,1-diamine;hydrochloride.
| Compound Name | 1-N',1-N'-diethyl-1-N-(2-methoxy-4-nitrophenyl)ethane-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 67922786 |
| Molecular Formula | C13H22ClN3O3 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-N',1-N'-diethyl-1-N-(2-methoxy-4-nitrophenyl)ethane-1,1-diamine;hydrochloride |
| SMILES | CCN(CC)C(C)Nc1ccc([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C13H21N3O3.ClH/c1-5-15(6-2)10(3)14-12-8-7-11(16(17)18)9-13(12)19-4;/h7-10,14H,5-6H2,1-4H3;1H |
| InChIKey | QDWXZGYQUHZUMK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|