About 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride
4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride (PubChem CID 67922843) has the molecular formula C11H24Cl2N2O
and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride |
| PubChem CID | 67922843 |
| Molecular Formula | C11H24Cl2N2O |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride |
| SMILES | CC(CCCl)C(O)N1CCN(C)CC1C.Cl |
| InChI | InChI=1S/C11H23ClN2O.ClH/c1-9(4-5-12)11(15)14-7-6-13(3)8-10(14)2;/h9-11,15H,4-8H2,1-3H3;1H |
| InChIKey | XGUXNKIMJALMAA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride?
The IUPAC name of 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride (CID 67922843) is 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride.
What is the SMILES notation for 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride?
The canonical SMILES for 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride is CC(CCCl)C(O)N1CCN(C)CC1C.Cl.
What is the InChIKey of 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride?
The InChIKey is XGUXNKIMJALMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23ClN2O.ClH/c1-9(4-5-12)11(15)14-7-6-13(3)8-10(14)2;/h9-11,15H,4-8H2,1-3H3;1H.
What are the key properties of 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride?
4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride has a molecular weight of 271.23 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2,4-dimethylpiperazin-1-yl)-2-methylbutan-1-ol;hydrochloride is sourced from PubChem (CID 67922843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).