C24H24N2O4 — CID 67923264
2-N,3-N-bis(4-hydroxyphenyl)-1-prop-2-enylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 67923264) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-N,3-N-bis(4-hydroxyphenyl)-1-prop-2-enylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | 2-N,3-N-bis(4-hydroxyphenyl)-1-prop-2-enylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67923264 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-N,3-N-bis(4-hydroxyphenyl)-1-prop-2-enylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | C=CCC12C=CC(C1)C(C(=O)Nc1ccc(O)cc1)C2C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-2-12-24-13-11-15(14-24)20(22(29)25-16-3-7-18(27)8-4-16)21(24)23(30)26-17-5-9-19(28)10-6-17/h2-11,13,15,20-21,27-28H,1,12,14H2,(H,25,29)(H,26,30) |
| InChIKey | GBRIZVFIAVWDIR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|