C35H42O4 — CID 67923683
7-[6-(3,5-dimethylphenyl)-2,2-dimethyl-4,4-diphenylcyclohexyl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 67923683) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is 7-[6-(3,5-dimethylphenyl)-2,2-dimethyl-4,4-diphenylcyclohexyl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | 7-[6-(3,5-dimethylphenyl)-2,2-dimethyl-4,4-diphenylcyclohexyl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 67923683 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 7-[6-(3,5-dimethylphenyl)-2,2-dimethyl-4,4-diphenylcyclohexyl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | Cc1cc(C)cc(C2CC(c3ccccc3)(c3ccccc3)CC(C)(C)C2C=CC(O)CC(O)CC(=O)O)c1 |
| InChI | InChI=1S/C35H42O4/c1-24-17-25(2)19-26(18-24)31-22-35(27-11-7-5-8-12-27,28-13-9-6-10-14-28)23-34(3,4)32(31)16-15-29(36)20-30(37)21-33(38)39/h5-19,29-32,36-37H,20-23H2,1-4H3,(H,38,39) |
| InChIKey | PQTSQXITSALQFB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|