C46H50F2N2O2 — CID 67924027
2-fluoro-5-[4-(4-heptoxyphenyl)phenyl]pyridine;2-fluoro-5-(1-pentoxy-4-phenylcyclohexa-2,5-dien-1-yl)pyridine (PubChem CID 67924027) has the molecular formula C46H50F2N2O2 and a molecular weight of 700.91 g/mol. Its IUPAC name is 2-fluoro-5-[4-(4-heptoxyphenyl)phenyl]pyridine;2-fluoro-5-(1-pentoxy-4-phenylcyclohexa-2,5-dien-1-yl)pyridine.
| Compound Name | 2-fluoro-5-[4-(4-heptoxyphenyl)phenyl]pyridine;2-fluoro-5-(1-pentoxy-4-phenylcyclohexa-2,5-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 67924027 |
| Molecular Formula | C46H50F2N2O2 |
| Molecular Weight | 700.91 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | 2-fluoro-5-[4-(4-heptoxyphenyl)phenyl]pyridine;2-fluoro-5-(1-pentoxy-4-phenylcyclohexa-2,5-dien-1-yl)pyridine |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(F)nc3)cc2)cc1.CCCCCOC1(c2ccc(F)nc2)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C24H26FNO.C22H24FNO/c1-2-3-4-5-6-17-27-23-14-11-20(12-15-23)19-7-9-21(10-8-19)22-13-16-24(25)26-18-22;1-2-3-7-16-25-22(20-10-11-21(23)24-17-20)14-12-19(13-15-22)18-8-5-4-6-9-18/h7-16,18H,2-6,17H2,1H3;4-6,8-15,17,19H,2-3,7,16H2,1H3 |
| InChIKey | IMGBVXISOGGRCR-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.91 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|