C47H46F4N2 — CID 67924035
3-[3-[4-(4-butylphenyl)phenyl]-4-(2,6-difluoro-3-pyridinyl)-2-[4-(4-pentylphenyl)phenyl]butan-2-yl]-2,6-difluoropyridine (PubChem CID 67924035) has the molecular formula C47H46F4N2 and a molecular weight of 714.89 g/mol. Its IUPAC name is 3-[3-[4-(4-butylphenyl)phenyl]-4-(2,6-difluoro-3-pyridinyl)-2-[4-(4-pentylphenyl)phenyl]butan-2-yl]-2,6-difluoropyridine.
| Compound Name | 3-[3-[4-(4-butylphenyl)phenyl]-4-(2,6-difluoro-3-pyridinyl)-2-[4-(4-pentylphenyl)phenyl]butan-2-yl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 67924035 |
| Molecular Formula | C47H46F4N2 |
| Molecular Weight | 714.89 g/mol |
| Exact Mass | 714.36 |
| IUPAC Name | 3-[3-[4-(4-butylphenyl)phenyl]-4-(2,6-difluoro-3-pyridinyl)-2-[4-(4-pentylphenyl)phenyl]butan-2-yl]-2,6-difluoropyridine |
| SMILES | CCCCCc1ccc(-c2ccc(C(C)(c3ccc(F)nc3F)C(Cc3ccc(F)nc3F)c3ccc(-c4ccc(CCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H46F4N2/c1-4-6-8-10-33-13-17-35(18-14-33)37-23-26-40(27-24-37)47(3,41-28-30-44(49)53-46(41)51)42(31-39-25-29-43(48)52-45(39)50)38-21-19-36(20-22-38)34-15-11-32(12-16-34)9-7-5-2/h11-30,42H,4-10,31H2,1-3H3 |
| InChIKey | ARCQOZMSNIRAHP-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.89 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|