About bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone
bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone (PubChem CID 67924498) has the molecular formula C31H48N2O5
and a molecular weight of 528.73 g/mol. Its IUPAC name is bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone.
Molecular Properties
| Compound Name | bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone |
| PubChem CID | 67924498 |
| Molecular Formula | C31H48N2O5 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone |
| SMILES | O=C(C1(C2CCCOC2)CC=CN(C2CCCOC2)C1)C1(C2CCCOC2)CC=CN(C2CCCOC2)C1 |
| InChI | InChI=1S/C31H48N2O5/c34-29(30(25-7-1-15-35-19-25)11-5-13-32(23-30)27-9-3-17-37-21-27)31(26-8-2-16-36-20-26)12-6-14-33(24-31)28-10-4-18-38-22-28/h5-6,13-14,25-28H,1-4,7-12,15-24H2 |
| InChIKey | OXIISXGDYZKGPI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone?
The IUPAC name of bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone (CID 67924498) is bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone.
What is the SMILES notation for bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone?
The canonical SMILES for bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone is O=C(C1(C2CCCOC2)CC=CN(C2CCCOC2)C1)C1(C2CCCOC2)CC=CN(C2CCCOC2)C1.
What is the InChIKey of bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone?
The InChIKey is OXIISXGDYZKGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H48N2O5/c34-29(30(25-7-1-15-35-19-25)11-5-13-32(23-30)27-9-3-17-37-21-27)31(26-8-2-16-36-20-26)12-6-14-33(24-31)28-10-4-18-38-22-28/h5-6,13-14,25-28H,1-4,7-12,15-24H2.
What are the key properties of bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone?
bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone has a molecular weight of 528.73 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1,3-bis(oxan-3-yl)-2,4-dihydropyridin-3-yl]methanone is sourced from PubChem (CID 67924498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).