C9H12N6O — CID 67924599
2,4-dimethyl-1,3,5-triazine;1H-imidazole-2-carboxamide (PubChem CID 67924599) has the molecular formula C9H12N6O and a molecular weight of 220.24 g/mol. Its IUPAC name is 2,4-dimethyl-1,3,5-triazine;1H-imidazole-2-carboxamide.
| Compound Name | 2,4-dimethyl-1,3,5-triazine;1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 67924599 |
| Molecular Formula | C9H12N6O |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2,4-dimethyl-1,3,5-triazine;1H-imidazole-2-carboxamide |
| SMILES | Cc1ncnc(C)n1.NC(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C5H7N3.C4H5N3O/c1-4-6-3-7-5(2)8-4;5-3(8)4-6-1-2-7-4/h3H,1-2H3;1-2H,(H2,5,8)(H,6,7) |
| InChIKey | NYHKJHCSBZILIA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |