About 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene (PubChem CID 67924780) has the molecular formula C18H24O3S
and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene.
Molecular Properties
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene |
| PubChem CID | 67924780 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene |
| SMILES | CCC(CO)(CO)CO.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C6H14O3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-6(3-7,4-8)5-9/h1-10H;7-9H,2-5H2,1H3 |
| InChIKey | CGFGUIZBSGTKTM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene?
The IUPAC name of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene (CID 67924780) is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene.
What is the SMILES notation for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene?
The canonical SMILES for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene is CCC(CO)(CO)CO.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene?
The InChIKey is CGFGUIZBSGTKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C6H14O3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-6(3-7,4-8)5-9/h1-10H;7-9H,2-5H2,1H3.
What are the key properties of 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene?
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene has a molecular weight of 320.45 g/mol, XLogP of 3.20, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;phenylsulfanylbenzene is sourced from PubChem (CID 67924780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).