C14H18N2O2SSi — CID 67924883
(7aR)-3-phenyl-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 67924883) has the molecular formula C14H18N2O2SSi and a molecular weight of 306.46 g/mol. Its IUPAC name is (7aR)-3-phenyl-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | (7aR)-3-phenyl-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 67924883 |
| Molecular Formula | C14H18N2O2SSi |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (7aR)-3-phenyl-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | C[Si](C)(C)N1C(=O)[C@@H]2CSC(c3ccccc3)N2C1=O |
| InChI | InChI=1S/C14H18N2O2SSi/c1-20(2,3)16-12(17)11-9-19-13(15(11)14(16)18)10-7-5-4-6-8-10/h4-8,11,13H,9H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | VJZWQFOMAOJLDD-AMGKYWFPSA-N |
| XLogP | 2.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|