C22H17ClF3N5 — CID 67924956
6-chloro-1-prop-2-enylbenzimidazole-5-carbonitrile;1-prop-2-enyl-5-(trifluoromethyl)benzimidazole (PubChem CID 67924956) has the molecular formula C22H17ClF3N5 and a molecular weight of 443.86 g/mol. Its IUPAC name is 6-chloro-1-prop-2-enylbenzimidazole-5-carbonitrile;1-prop-2-enyl-5-(trifluoromethyl)benzimidazole.
| Compound Name | 6-chloro-1-prop-2-enylbenzimidazole-5-carbonitrile;1-prop-2-enyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 67924956 |
| Molecular Formula | C22H17ClF3N5 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 6-chloro-1-prop-2-enylbenzimidazole-5-carbonitrile;1-prop-2-enyl-5-(trifluoromethyl)benzimidazole |
| SMILES | C=CCn1cnc2cc(C#N)c(Cl)cc21.C=CCn1cnc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H8ClN3.C11H9F3N2/c1-2-3-15-7-14-10-4-8(6-13)9(12)5-11(10)15;1-2-5-16-7-15-9-6-8(11(12,13)14)3-4-10(9)16/h2,4-5,7H,1,3H2;2-4,6-7H,1,5H2 |
| InChIKey | NNSCSPGOJLDJTA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|