About 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride
2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride (PubChem CID 67924960) has the molecular formula C6H12ClNOS
and a molecular weight of 181.69 g/mol. Its IUPAC name is 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride |
| PubChem CID | 67924960 |
| Molecular Formula | C6H12ClNOS |
| Molecular Weight | 181.69 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride |
| SMILES | CCCN1CC=CS1=O.Cl |
| InChI | InChI=1S/C6H11NOS.ClH/c1-2-4-7-5-3-6-9(7)8;/h3,6H,2,4-5H2,1H3;1H |
| InChIKey | XBNMDSSYSMARBF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The IUPAC name of 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride (CID 67924960) is 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride.
What is the SMILES notation for 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The canonical SMILES for 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride is CCCN1CC=CS1=O.Cl.
What is the InChIKey of 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride?
The InChIKey is XBNMDSSYSMARBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS.ClH/c1-2-4-7-5-3-6-9(7)8;/h3,6H,2,4-5H2,1H3;1H.
What are the key properties of 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride?
2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride has a molecular weight of 181.69 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-3H-1,2-thiazole 1-oxide;hydrochloride is sourced from PubChem (CID 67924960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).