About 2-propyl-3H-1,2-thiazole 1-oxide
2-propyl-3H-1,2-thiazole 1-oxide (PubChem CID 67924961) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 2-propyl-3H-1,2-thiazole 1-oxide.
Molecular Properties
| Compound Name | 2-propyl-3H-1,2-thiazole 1-oxide |
| PubChem CID | 67924961 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-propyl-3H-1,2-thiazole 1-oxide |
| SMILES | CCCN1CC=CS1=O |
| InChI | InChI=1S/C6H11NOS/c1-2-4-7-5-3-6-9(7)8/h3,6H,2,4-5H2,1H3 |
| InChIKey | GRVFULSUNJBTEM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propyl-3H-1,2-thiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-3H-1,2-thiazole 1-oxide?
The IUPAC name of 2-propyl-3H-1,2-thiazole 1-oxide (CID 67924961) is 2-propyl-3H-1,2-thiazole 1-oxide.
What is the SMILES notation for 2-propyl-3H-1,2-thiazole 1-oxide?
The canonical SMILES for 2-propyl-3H-1,2-thiazole 1-oxide is CCCN1CC=CS1=O.
What is the InChIKey of 2-propyl-3H-1,2-thiazole 1-oxide?
The InChIKey is GRVFULSUNJBTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-2-4-7-5-3-6-9(7)8/h3,6H,2,4-5H2,1H3.
What are the key properties of 2-propyl-3H-1,2-thiazole 1-oxide?
2-propyl-3H-1,2-thiazole 1-oxide has a molecular weight of 145.23 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-3H-1,2-thiazole 1-oxide is sourced from PubChem (CID 67924961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).