About 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine
4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine (PubChem CID 67925259) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine |
| PubChem CID | 67925259 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine |
| SMILES | NC1CCC(N2C=CC(C3=CCC=CC3)=CC2)CC1 |
| InChI | InChI=1S/C17H24N2/c18-16-6-8-17(9-7-16)19-12-10-15(11-13-19)14-4-2-1-3-5-14/h1-2,5,10-12,16-17H,3-4,6-9,13,18H2 |
| InChIKey | USMMINAQFCOVGC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine?
The IUPAC name of 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine (CID 67925259) is 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine.
What is the SMILES notation for 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine?
The canonical SMILES for 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine is NC1CCC(N2C=CC(C3=CCC=CC3)=CC2)CC1.
What is the InChIKey of 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine?
The InChIKey is USMMINAQFCOVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c18-16-6-8-17(9-7-16)19-12-10-15(11-13-19)14-4-2-1-3-5-14/h1-2,5,10-12,16-17H,3-4,6-9,13,18H2.
What are the key properties of 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine?
4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine has a molecular weight of 256.39 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclohexa-1,4-dien-1-yl-2H-pyridin-1-yl)cyclohexan-1-amine is sourced from PubChem (CID 67925259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).