C29H39N5O6 — CID 67925548
1-[1-(butylcarbamoyloxy)ethyl-[2-(1,3-dioxoisoindol-2-yl)-2-pyridin-4-ylethyl]amino]ethyl N-butylcarbamate (PubChem CID 67925548) has the molecular formula C29H39N5O6 and a molecular weight of 553.66 g/mol. Its IUPAC name is 1-[1-(butylcarbamoyloxy)ethyl-[2-(1,3-dioxoisoindol-2-yl)-2-pyridin-4-ylethyl]amino]ethyl N-butylcarbamate.
| Compound Name | 1-[1-(butylcarbamoyloxy)ethyl-[2-(1,3-dioxoisoindol-2-yl)-2-pyridin-4-ylethyl]amino]ethyl N-butylcarbamate |
|---|---|
| PubChem CID | 67925548 |
| Molecular Formula | C29H39N5O6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 1-[1-(butylcarbamoyloxy)ethyl-[2-(1,3-dioxoisoindol-2-yl)-2-pyridin-4-ylethyl]amino]ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC(C)N(CC(c1ccncc1)N1C(=O)c2ccccc2C1=O)C(C)OC(=O)NCCCC |
| InChI | InChI=1S/C29H39N5O6/c1-5-7-15-31-28(37)39-20(3)33(21(4)40-29(38)32-16-8-6-2)19-25(22-13-17-30-18-14-22)34-26(35)23-11-9-10-12-24(23)27(34)36/h9-14,17-18,20-21,25H,5-8,15-16,19H2,1-4H3,(H,31,37)(H,32,38) |
| InChIKey | PCKRZTJEFONGOF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|