About 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile
4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile (PubChem CID 67925609) has the molecular formula C15H16N4O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile |
| PubChem CID | 67925609 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile |
| SMILES | Cc1cc(C)c(C#N)c(=O)[nH]1.N#CCCn1cccc1 |
| InChI | InChI=1S/C8H8N2O.C7H8N2/c1-5-3-6(2)10-8(11)7(5)4-9;8-4-3-7-9-5-1-2-6-9/h3H,1-2H3,(H,10,11);1-2,5-6H,3,7H2 |
| InChIKey | QYAOECMEWQWDBJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile?
The IUPAC name of 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile (CID 67925609) is 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile.
What is the SMILES notation for 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile?
The canonical SMILES for 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile is Cc1cc(C)c(C#N)c(=O)[nH]1.N#CCCn1cccc1.
What is the InChIKey of 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile?
The InChIKey is QYAOECMEWQWDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.C7H8N2/c1-5-3-6(2)10-8(11)7(5)4-9;8-4-3-7-9-5-1-2-6-9/h3H,1-2H3,(H,10,11);1-2,5-6H,3,7H2.
What are the key properties of 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile?
4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile has a molecular weight of 268.32 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile;3-pyrrol-1-ylpropanenitrile is sourced from PubChem (CID 67925609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).