C11H15NO2 — CID 67925703
4,5-dihydro-1,3-oxazole;2,6-dimethylphenol (PubChem CID 67925703) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;2,6-dimethylphenol.
| Compound Name | 4,5-dihydro-1,3-oxazole;2,6-dimethylphenol |
|---|---|
| PubChem CID | 67925703 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;2,6-dimethylphenol |
| SMILES | C1=NCCO1.Cc1cccc(C)c1O |
| InChI | InChI=1S/C8H10O.C3H5NO/c1-6-4-3-5-7(2)8(6)9;1-2-5-3-4-1/h3-5,9H,1-2H3;3H,1-2H2 |
| InChIKey | BSGJXOCZVQOLLM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |