About 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one
2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 67925918) has the molecular formula C12H8ClN3OS2
and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| PubChem CID | 67925918 |
| Molecular Formula | C12H8ClN3OS2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | O=c1cc(Cl)n2nc(SCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C12H8ClN3OS2/c13-9-6-10(17)14-11-16(9)15-12(19-11)18-7-8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | DDVQWJXPALVUHO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The IUPAC name of 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (CID 67925918) is 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
What is the SMILES notation for 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The canonical SMILES for 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one is O=c1cc(Cl)n2nc(SCc3ccccc3)sc2n1.
What is the InChIKey of 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
The InChIKey is DDVQWJXPALVUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3OS2/c13-9-6-10(17)14-11-16(9)15-12(19-11)18-7-8-4-2-1-3-5-8/h1-6H,7H2.
What are the key properties of 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one?
2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one has a molecular weight of 309.80 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-5-chloro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one is sourced from PubChem (CID 67925918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).