C12H16N2 — CID 67926157
4a,6,7,8,9,9a,10,10a-octahydropyrido[2,3-g]quinoline (PubChem CID 67926157) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 4a,6,7,8,9,9a,10,10a-octahydropyrido[2,3-g]quinoline.
| Compound Name | 4a,6,7,8,9,9a,10,10a-octahydropyrido[2,3-g]quinoline |
|---|---|
| PubChem CID | 67926157 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4a,6,7,8,9,9a,10,10a-octahydropyrido[2,3-g]quinoline |
| SMILES | C1=CC2C=C3NCCCC3CC2N=C1 |
| InChI | InChI=1S/C12H16N2/c1-3-9-7-12-10(4-2-6-14-12)8-11(9)13-5-1/h1,3,5,7,9-11,14H,2,4,6,8H2 |
| InChIKey | QSZXAPLYYOLMDM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |