About chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one
chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 67926193) has the molecular formula C15H19ClO
and a molecular weight of 250.77 g/mol. Its IUPAC name is chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one |
| PubChem CID | 67926193 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.Clc1ccccc1 |
| InChI | InChI=1S/C9H14O.C6H5Cl/c1-7-4-8(10)6-9(2,3)5-7;7-6-4-2-1-3-5-6/h4H,5-6H2,1-3H3;1-5H |
| InChIKey | SVWFGHYLULZXOF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one?
The IUPAC name of chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one (CID 67926193) is chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one?
The canonical SMILES for chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one is CC1=CC(=O)CC(C)(C)C1.Clc1ccccc1.
What is the InChIKey of chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one?
The InChIKey is SVWFGHYLULZXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C6H5Cl/c1-7-4-8(10)6-9(2,3)5-7;7-6-4-2-1-3-5-6/h4H,5-6H2,1-3H3;1-5H.
What are the key properties of chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one?
chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one has a molecular weight of 250.77 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;3,5,5-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 67926193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).