About (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine
(4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 67926713) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine |
| PubChem CID | 67926713 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine |
| SMILES | COC1=C(OC)CC(C)(CN)C=C1 |
| InChI | InChI=1S/C10H17NO2/c1-10(7-11)5-4-8(12-2)9(6-10)13-3/h4-5H,6-7,11H2,1-3H3 |
| InChIKey | AXZNWYREAOATPR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine?
The IUPAC name of (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine (CID 67926713) is (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine.
What is the SMILES notation for (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine?
The canonical SMILES for (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine is COC1=C(OC)CC(C)(CN)C=C1.
What is the InChIKey of (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine?
The InChIKey is AXZNWYREAOATPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-10(7-11)5-4-8(12-2)9(6-10)13-3/h4-5H,6-7,11H2,1-3H3.
What are the key properties of (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine?
(4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine has a molecular weight of 183.25 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethoxy-1-methylcyclohexa-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 67926713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).